C26H19ClF13NO3 — CID 147983693
(2S)-4-[4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 147983693) has the molecular formula C26H19ClF13NO3 and a molecular weight of 675.87 g/mol. Its IUPAC name is (2S)-4-[4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 147983693 |
| Molecular Formula | C26H19ClF13NO3 |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 675.08 |
| IUPAC Name | (2S)-4-[4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | C[C@@H](CC(=O)c1ccc(/C(F)=C/C(c2ccc(OCC(F)(F)F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C26H19ClF13NO3/c1-12(22(43)41-10-23(29,30)31)6-20(42)15-4-2-14(7-17(15)26(38,39)40)19(28)9-16(25(35,36)37)13-3-5-21(18(27)8-13)44-11-24(32,33)34/h2-5,7-9,12,16H,6,10-11H2,1H3,(H,41,43)/b19-9-/t12-,16?/m0/s1 |
| InChIKey | ITSGTKBMZYZZRA-HWTOVGDOSA-N |
| XLogP | 8.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |