C25H18ClF11O2 — CID 159857546
(3R)-1-[4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-7,7,7-trifluoro-3-methylheptane-1,5-dione (PubChem CID 159857546) has the molecular formula C25H18ClF11O2 and a molecular weight of 594.85 g/mol. Its IUPAC name is (3R)-1-[4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-7,7,7-trifluoro-3-methylheptane-1,5-dione.
| Compound Name | (3R)-1-[4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-7,7,7-trifluoro-3-methylheptane-1,5-dione |
|---|---|
| PubChem CID | 159857546 |
| Molecular Formula | C25H18ClF11O2 |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | (3R)-1-[4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-7,7,7-trifluoro-3-methylheptane-1,5-dione |
| SMILES | C[C@H](CC(=O)CC(F)(F)F)CC(=O)c1ccc(/C(F)=C/C(c2ccc(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H18ClF11O2/c1-12(6-15(38)11-23(29,30)31)7-22(39)16-4-2-14(8-18(16)25(35,36)37)21(28)10-17(24(32,33)34)13-3-5-20(27)19(26)9-13/h2-5,8-10,12,17H,6-7,11H2,1H3/b21-10-/t12-,17?/m1/s1 |
| InChIKey | NQSINLLACSICML-IZBUMORXSA-N |
| XLogP | 9.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |