C24H17Br2ClF10OS — CID 147344648
(3S)-1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one (PubChem CID 147344648) has the molecular formula C24H17Br2ClF10OS and a molecular weight of 738.71 g/mol. Its IUPAC name is (3S)-1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one.
| Compound Name | (3S)-1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one |
|---|---|
| PubChem CID | 147344648 |
| Molecular Formula | C24H17Br2ClF10OS |
| Molecular Weight | 738.71 g/mol |
| Exact Mass | 735.89 |
| IUPAC Name | (3S)-1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one |
| SMILES | C[C@H](CSCC(F)(F)F)CC(=O)c1ccc(/C(F)=C/C(c2cc(Br)c(Cl)c(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H17Br2ClF10OS/c1-11(9-39-10-22(29,30)31)4-20(38)14-3-2-12(5-16(14)24(35,36)37)19(28)8-15(23(32,33)34)13-6-17(25)21(27)18(26)7-13/h2-3,5-8,11,15H,4,9-10H2,1H3/b19-8-/t11-,15?/m0/s1 |
| InChIKey | DEENQZYVHZTPOG-UUQVMJQESA-N |
| XLogP | 11.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.71 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|