C23H18BrCl3F7NO — CID 149194288
(3S)-1-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylamino)butan-1-one (PubChem CID 149194288) has the molecular formula C23H18BrCl3F7NO and a molecular weight of 643.65 g/mol. Its IUPAC name is (3S)-1-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylamino)butan-1-one.
| Compound Name | (3S)-1-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylamino)butan-1-one |
|---|---|
| PubChem CID | 149194288 |
| Molecular Formula | C23H18BrCl3F7NO |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 640.95 |
| IUPAC Name | (3S)-1-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-3-methyl-4-(2,2,2-trifluoroethylamino)butan-1-one |
| SMILES | C[C@H](CNCC(F)(F)F)CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C23H18BrCl3F7NO/c1-11(9-35-10-22(29,30)31)4-20(36)14-3-2-12(5-16(14)24)19(28)8-15(23(32,33)34)13-6-17(25)21(27)18(26)7-13/h2-3,5-8,11,15,35H,4,9-10H2,1H3/b19-8-/t11-,15?/m0/s1 |
| InChIKey | XDLDZYKDWZQCCO-UUQVMJQESA-N |
| XLogP | 9.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|