C25H21BrCl3F6NO2 — CID 159620697
(2S)-4-[2-bromo-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-N,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 159620697) has the molecular formula C25H21BrCl3F6NO2 and a molecular weight of 667.70 g/mol. Its IUPAC name is (2S)-4-[2-bromo-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-N,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[2-bromo-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-N,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 159620697 |
| Molecular Formula | C25H21BrCl3F6NO2 |
| Molecular Weight | 667.70 g/mol |
| Exact Mass | 664.97 |
| IUPAC Name | (2S)-4-[2-bromo-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]-N,2-dimethyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | C[C@@H](CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(C)(F)F)cc1Br)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C25H21BrCl3F6NO2/c1-12(23(38)36(3)11-25(33,34)35)6-21(37)15-5-4-13(7-17(15)26)20(30)10-16(24(2,31)32)14-8-18(27)22(29)19(28)9-14/h4-5,7-10,12,16H,6,11H2,1-3H3/b20-10-/t12-,16?/m0/s1 |
| InChIKey | MNVOUWHPWJVGJR-PJXOFOQKSA-N |
| XLogP | 9.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.70 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|