C23H16Cl4F7NO2 — CID 147501964
4-[2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 147501964) has the molecular formula C23H16Cl4F7NO2 and a molecular weight of 613.18 g/mol. Its IUPAC name is 4-[2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-[2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 147501964 |
| Molecular Formula | C23H16Cl4F7NO2 |
| Molecular Weight | 613.18 g/mol |
| Exact Mass | 610.98 |
| IUPAC Name | 4-[2-chloro-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CN(CC(F)(F)F)C(=O)CCC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H16Cl4F7NO2/c1-35(10-22(29,30)31)20(37)5-4-19(36)13-3-2-11(6-15(13)24)18(28)9-14(23(32,33)34)12-7-16(25)21(27)17(26)8-12/h2-3,6-9,14H,4-5,10H2,1H3/b18-9- |
| InChIKey | FHOZDBUNMDLPNJ-NVMNQCDNSA-N |
| XLogP | 8.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.18 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|