C21H12Cl3F10NO — CID 130238223
N-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(2,2,2-trifluoroethyl)-2-(trifluoromethyl)benzamide (PubChem CID 130238223) has the molecular formula C21H12Cl3F10NO and a molecular weight of 590.67 g/mol. Its IUPAC name is N-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(2,2,2-trifluoroethyl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(2,2,2-trifluoroethyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130238223 |
| Molecular Formula | C21H12Cl3F10NO |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 588.98 |
| IUPAC Name | N-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(2,2,2-trifluoroethyl)-2-(trifluoromethyl)benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H12Cl3F10NO/c1-35(8-19(26,27)28)18(36)11-3-2-9(4-13(11)21(32,33)34)16(25)7-12(20(29,30)31)10-5-14(22)17(24)15(23)6-10/h2-7,12H,8H2,1H3/b16-7- |
| InChIKey | YVNKCZJMSVQBBY-APSNUPSMSA-N |
| XLogP | 8.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|