C20H11Cl3F7NO2S — CID 130236889
2-[[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioyl]amino]acetic acid (PubChem CID 130236889) has the molecular formula C20H11Cl3F7NO2S and a molecular weight of 568.73 g/mol. Its IUPAC name is 2-[[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioyl]amino]acetic acid.
| Compound Name | 2-[[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioyl]amino]acetic acid |
|---|---|
| PubChem CID | 130236889 |
| Molecular Formula | C20H11Cl3F7NO2S |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 566.95 |
| IUPAC Name | 2-[[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzenecarbothioyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=S)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H11Cl3F7NO2S/c21-13-4-9(5-14(22)17(13)23)11(19(25,26)27)6-15(24)8-1-2-10(12(3-8)20(28,29)30)18(34)31-7-16(32)33/h1-6,11H,7H2,(H,31,34)(H,32,33)/b15-6- |
| InChIKey | HCORPPGKZQEBSX-UUASQNMZSA-N |
| XLogP | 7.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|