C22H14Cl3F10N3O2 — CID 135341355
2-[amino-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 135341355) has the molecular formula C22H14Cl3F10N3O2 and a molecular weight of 648.71 g/mol. Its IUPAC name is 2-[amino-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[amino-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 135341355 |
| Molecular Formula | C22H14Cl3F10N3O2 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 647.00 |
| IUPAC Name | 2-[amino-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | NN(CC(=O)NCC(F)(F)F)C(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H14Cl3F10N3O2/c23-14-4-10(5-15(24)18(14)25)12(21(30,31)32)6-16(26)9-1-2-11(13(3-9)22(33,34)35)19(40)38(36)7-17(39)37-8-20(27,28)29/h1-6,12H,7-8,36H2,(H,37,39)/b16-6- |
| InChIKey | YAGOCCIEYLQWQY-SOFYXZRVSA-N |
| XLogP | 7.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|