C26H19Cl2F12NO2 — CID 161260712
(2S)-4-[4-[(Z)-3-[3,4-dichloro-5-(1,1-difluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 161260712) has the molecular formula C26H19Cl2F12NO2 and a molecular weight of 676.32 g/mol. Its IUPAC name is (2S)-4-[4-[(Z)-3-[3,4-dichloro-5-(1,1-difluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[4-[(Z)-3-[3,4-dichloro-5-(1,1-difluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 161260712 |
| Molecular Formula | C26H19Cl2F12NO2 |
| Molecular Weight | 676.32 g/mol |
| Exact Mass | 675.06 |
| IUPAC Name | (2S)-4-[4-[(Z)-3-[3,4-dichloro-5-(1,1-difluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | C[C@@H](CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(C(C)(F)F)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C26H19Cl2F12NO2/c1-11(22(43)41-10-24(32,33)34)5-20(42)14-4-3-12(6-16(14)26(38,39)40)19(29)9-15(25(35,36)37)13-7-17(23(2,30)31)21(28)18(27)8-13/h3-4,6-9,11,15H,5,10H2,1-2H3,(H,41,43)/b19-9-/t11-,15?/m0/s1 |
| InChIKey | VCMWABXUJPZTCO-OIYXXMCPSA-N |
| XLogP | 9.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.32 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |