C22H13Cl2F11O — CID 161018619
1-[4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4,4,4-trifluoro-3-methylbutan-1-one (PubChem CID 161018619) has the molecular formula C22H13Cl2F11O and a molecular weight of 573.23 g/mol. Its IUPAC name is 1-[4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4,4,4-trifluoro-3-methylbutan-1-one.
| Compound Name | 1-[4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4,4,4-trifluoro-3-methylbutan-1-one |
|---|---|
| PubChem CID | 161018619 |
| Molecular Formula | C22H13Cl2F11O |
| Molecular Weight | 573.23 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | 1-[4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4,4,4-trifluoro-3-methylbutan-1-one |
| SMILES | CC(CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H13Cl2F11O/c1-9(20(27,28)29)4-18(36)12-3-2-10(5-14(12)22(33,34)35)17(25)8-13(21(30,31)32)11-6-15(23)19(26)16(24)7-11/h2-3,5-9,13H,4H2,1H3/b17-8- |
| InChIKey | TYBFXCUUAFHZRS-IUXPMGMMSA-N |
| XLogP | 9.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.23 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|