C18H8BrCl2F7O2 — CID 130236224
4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 130236224) has the molecular formula C18H8BrCl2F7O2 and a molecular weight of 540.06 g/mol. Its IUPAC name is 4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 130236224 |
| Molecular Formula | C18H8BrCl2F7O2 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 537.90 |
| IUPAC Name | 4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Br)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H8BrCl2F7O2/c19-15-12(20)4-8(5-13(15)21)10(17(23,24)25)6-14(22)7-1-2-9(16(29)30)11(3-7)18(26,27)28/h1-6,10H,(H,29,30)/b14-6- |
| InChIKey | KREPUSSXBUIUAK-NSIKDUERSA-N |
| XLogP | 8.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|