C24H17BrCl2F10N2O2 — CID 130236761
4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236761) has the molecular formula C24H17BrCl2F10N2O2 and a molecular weight of 706.20 g/mol. Its IUPAC name is 4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236761 |
| Molecular Formula | C24H17BrCl2F10N2O2 |
| Molecular Weight | 706.20 g/mol |
| Exact Mass | 703.97 |
| IUPAC Name | 4-[(Z)-3-(4-bromo-3,5-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Br)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C24H17BrCl2F10N2O2/c1-10(21(41)39(2)9-22(29,30)31)38-20(40)13-4-3-11(5-15(13)24(35,36)37)18(28)8-14(23(32,33)34)12-6-16(26)19(25)17(27)7-12/h3-8,10,14H,9H2,1-2H3,(H,38,40)/b18-8- |
| InChIKey | GIBBWJKCPXHFOV-LSCVHKIXSA-N |
| XLogP | 8.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.20 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|