C22H15Cl2F10N3O2 — CID 130236250
1-[[4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 130236250) has the molecular formula C22H15Cl2F10N3O2 and a molecular weight of 614.27 g/mol. Its IUPAC name is 1-[[4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[[4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 130236250 |
| Molecular Formula | C22H15Cl2F10N3O2 |
| Molecular Weight | 614.27 g/mol |
| Exact Mass | 613.04 |
| IUPAC Name | 1-[[4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)benzoyl]amino]-1-methyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(NC(=O)c1ccc(/C(F)=C/C(c2ccc(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C22H15Cl2F10N3O2/c1-37(19(39)35-9-20(26,27)28)36-18(38)12-4-2-11(6-14(12)22(32,33)34)17(25)8-13(21(29,30)31)10-3-5-15(23)16(24)7-10/h2-8,13H,9H2,1H3,(H,35,39)(H,36,38)/b17-8- |
| InChIKey | QIBGHAXIVNNDTF-IUXPMGMMSA-N |
| XLogP | 7.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.27 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|