C24H19Cl2F9N2O2 — CID 130236789
4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236789) has the molecular formula C24H19Cl2F9N2O2 and a molecular weight of 609.32 g/mol. Its IUPAC name is 4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236789 |
| Molecular Formula | C24H19Cl2F9N2O2 |
| Molecular Weight | 609.32 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | 4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2ccc(Cl)c(Cl)c2)C(C)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H19Cl2F9N2O2/c1-11(20(38)36-10-23(30,31)32)37-21(39)14-5-3-13(7-16(14)24(33,34)35)19(27)9-15(22(2,28)29)12-4-6-17(25)18(26)8-12/h3-9,11,15H,10H2,1-2H3,(H,36,38)(H,37,39)/b19-9-/t11-,15?/m1/s1 |
| InChIKey | NKPIRJXDWCYCPZ-ZVHPCQIWSA-N |
| XLogP | 7.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.32 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |