C25H22Cl3F7N2O2 — CID 130237203
N-[1-(butylamino)-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 130237203) has the molecular formula C25H22Cl3F7N2O2 and a molecular weight of 621.81 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(butylamino)-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237203 |
| Molecular Formula | C25H22Cl3F7N2O2 |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | N-[1-(butylamino)-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCCCNC(=O)C(C)NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22Cl3F7N2O2/c1-3-4-7-36-22(38)12(2)37-23(39)15-6-5-13(8-17(15)25(33,34)35)20(29)11-16(24(30,31)32)14-9-18(26)21(28)19(27)10-14/h5-6,8-12,16H,3-4,7H2,1-2H3,(H,36,38)(H,37,39)/b20-11- |
| InChIKey | XFAHNTDDYDLRBK-JAIQZWGSSA-N |
| XLogP | 8.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|