C22H16Cl3F8NOS — CID 140800291
N-[2-(2-fluoroethylsulfanyl)ethyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800291) has the molecular formula C22H16Cl3F8NOS and a molecular weight of 600.79 g/mol. Its IUPAC name is N-[2-(2-fluoroethylsulfanyl)ethyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(2-fluoroethylsulfanyl)ethyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800291 |
| Molecular Formula | C22H16Cl3F8NOS |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 598.99 |
| IUPAC Name | N-[2-(2-fluoroethylsulfanyl)ethyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCSCCF)c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H16Cl3F8NOS/c23-16-8-12(9-17(24)19(16)25)14(21(28,29)30)10-18(27)11-1-2-13(15(7-11)22(31,32)33)20(35)34-4-6-36-5-3-26/h1-2,7-10,14H,3-6H2,(H,34,35) |
| InChIKey | OWMFZRJEAQRLNC-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|