C27H22Cl3F7N2O2 — CID 140800192
N-[1-(2-cyclopropylethylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800192) has the molecular formula C27H22Cl3F7N2O2 and a molecular weight of 645.83 g/mol. Its IUPAC name is N-[1-(2-cyclopropylethylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(2-cyclopropylethylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800192 |
| Molecular Formula | C27H22Cl3F7N2O2 |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 644.06 |
| IUPAC Name | N-[1-(2-cyclopropylethylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1(C(=O)NCCC2CC2)CC1)c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C27H22Cl3F7N2O2/c28-19-10-15(11-20(29)22(19)30)17(26(32,33)34)12-21(31)14-3-4-16(18(9-14)27(35,36)37)23(40)39-25(6-7-25)24(41)38-8-5-13-1-2-13/h3-4,9-13,17H,1-2,5-8H2,(H,38,41)(H,39,40) |
| InChIKey | AROCTUQHKFHQBV-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|