C25H16Cl3F7N2O2 — CID 140800230
N-[1-(prop-2-ynylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800230) has the molecular formula C25H16Cl3F7N2O2 and a molecular weight of 615.76 g/mol. Its IUPAC name is N-[1-(prop-2-ynylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(prop-2-ynylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800230 |
| Molecular Formula | C25H16Cl3F7N2O2 |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 614.02 |
| IUPAC Name | N-[1-(prop-2-ynylcarbamoyl)cyclopropyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C#CCNC(=O)C1(NC(=O)c2ccc(C(F)=CC(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H16Cl3F7N2O2/c1-2-7-36-22(39)23(5-6-23)37-21(38)14-4-3-12(8-16(14)25(33,34)35)19(29)11-15(24(30,31)32)13-9-17(26)20(28)18(27)10-13/h1,3-4,8-11,15H,5-7H2,(H,36,39)(H,37,38) |
| InChIKey | OCLHCKOIBNHUTB-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|