C24H17Cl4F7N2O2 — CID 130237173
2-chloro-N-[1-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclopropyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130237173) has the molecular formula C24H17Cl4F7N2O2 and a molecular weight of 640.21 g/mol. Its IUPAC name is 2-chloro-N-[1-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclopropyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-chloro-N-[1-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclopropyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130237173 |
| Molecular Formula | C24H17Cl4F7N2O2 |
| Molecular Weight | 640.21 g/mol |
| Exact Mass | 637.99 |
| IUPAC Name | 2-chloro-N-[1-[methyl(2,2,2-trifluoroethyl)carbamoyl]cyclopropyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)C1(NC(=O)c2ccc(/C(F)=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C24H17Cl4F7N2O2/c1-37(10-23(30,31)32)21(39)22(4-5-22)36-20(38)13-3-2-11(6-15(13)25)18(29)9-14(24(33,34)35)12-7-16(26)19(28)17(27)8-12/h2-3,6-9,14H,4-5,10H2,1H3,(H,36,38)/b18-9- |
| InChIKey | UDHCIBGXMMPOEB-NVMNQCDNSA-N |
| XLogP | 8.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.21 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|