C24H22Cl3F7N2O — CID 130268940
2-methyl-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130268940) has the molecular formula C24H22Cl3F7N2O and a molecular weight of 593.80 g/mol. Its IUPAC name is 2-methyl-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-methyl-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130268940 |
| Molecular Formula | C24H22Cl3F7N2O |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | 2-methyl-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)N[C@H](C)CN(C)CC(F)(F)F |
| InChI | InChI=1S/C24H22Cl3F7N2O/c1-12-6-14(4-5-16(12)22(37)35-13(2)10-36(3)11-23(29,30)31)20(28)9-17(24(32,33)34)15-7-18(25)21(27)19(26)8-15/h4-9,13,17H,10-11H2,1-3H3,(H,35,37)/b20-9-/t13-,17?/m1/s1 |
| InChIKey | JPGVBMVDOLKEAZ-RVBGZCLRSA-N |
| XLogP | 8.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|