C25H21Cl3F4N4O — CID 158542559
2-methyl-N-propan-2-yl-N'-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide (PubChem CID 158542559) has the molecular formula C25H21Cl3F4N4O and a molecular weight of 575.82 g/mol. Its IUPAC name is 2-methyl-N-propan-2-yl-N'-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide.
| Compound Name | 2-methyl-N-propan-2-yl-N'-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 158542559 |
| Molecular Formula | C25H21Cl3F4N4O |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 2-methyl-N-propan-2-yl-N'-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
| SMILES | Cc1cc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)N(Nc1ncccn1)C(C)C |
| InChI | InChI=1S/C25H21Cl3F4N4O/c1-13(2)36(35-24-33-7-4-8-34-24)23(37)17-6-5-15(9-14(17)3)21(29)12-18(25(30,31)32)16-10-19(26)22(28)20(27)11-16/h4-13,18H,1-3H3,(H,33,34,35)/b21-12- |
| InChIKey | HOSAHDKYIBCOJQ-MTJSOVHGSA-N |
| XLogP | 8.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|