C26H18Cl3F4N3O — CID 159403650
1-[2-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-[prop-2-ynyl(pyrimidin-2-yl)amino]ethanone (PubChem CID 159403650) has the molecular formula C26H18Cl3F4N3O and a molecular weight of 570.80 g/mol. Its IUPAC name is 1-[2-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-[prop-2-ynyl(pyrimidin-2-yl)amino]ethanone.
| Compound Name | 1-[2-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-[prop-2-ynyl(pyrimidin-2-yl)amino]ethanone |
|---|---|
| PubChem CID | 159403650 |
| Molecular Formula | C26H18Cl3F4N3O |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 569.05 |
| IUPAC Name | 1-[2-methyl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-2-[prop-2-ynyl(pyrimidin-2-yl)amino]ethanone |
| SMILES | C#CCN(CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C)c1ncccn1 |
| InChI | InChI=1S/C26H18Cl3F4N3O/c1-3-9-36(25-34-7-4-8-35-25)14-23(37)18-6-5-16(10-15(18)2)22(30)13-19(26(31,32)33)17-11-20(27)24(29)21(28)12-17/h1,4-8,10-13,19H,9,14H2,2H3/b22-13- |
| InChIKey | LNRDVJALKPTNBK-XKZIYDEJSA-N |
| XLogP | 7.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|