C21H13Cl3F4N4O — CID 135348292
2-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide (PubChem CID 135348292) has the molecular formula C21H13Cl3F4N4O and a molecular weight of 519.71 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide.
| Compound Name | 2-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 135348292 |
| Molecular Formula | C21H13Cl3F4N4O |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 2-pyrimidin-2-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1-c1ncccn1 |
| InChI | InChI=1S/C21H13Cl3F4N4O/c22-15-7-11(8-16(23)18(15)24)14(21(26,27)28)9-17(25)10-2-3-12(20(33)32-29)13(6-10)19-30-4-1-5-31-19/h1-9,14H,29H2,(H,32,33)/b17-9- |
| InChIKey | GHXYFDJTBULLSF-MFOYZWKCSA-N |
| XLogP | 6.36 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|