C22H12Cl3F7N4O — CID 135348350
3-pyrimidin-5-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135348350) has the molecular formula C22H12Cl3F7N4O and a molecular weight of 587.71 g/mol. Its IUPAC name is 3-pyrimidin-5-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | 3-pyrimidin-5-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135348350 |
| Molecular Formula | C22H12Cl3F7N4O |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 3-pyrimidin-5-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)c(-c2cncnc2)c1C(F)(F)F |
| InChI | InChI=1S/C22H12Cl3F7N4O/c23-14-3-9(4-15(24)19(14)25)13(21(27,28)29)5-16(26)11-1-2-12(20(37)36-33)18(22(30,31)32)17(11)10-6-34-8-35-7-10/h1-8,13H,33H2,(H,36,37) |
| InChIKey | FUWPFBYAWGRQFC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|