C21H14Cl3F7N2O2 — CID 140800269
3-[(2R)-1-amino-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800269) has the molecular formula C21H14Cl3F7N2O2 and a molecular weight of 565.70 g/mol. Its IUPAC name is 3-[(2R)-1-amino-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 3-[(2R)-1-amino-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800269 |
| Molecular Formula | C21H14Cl3F7N2O2 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 3-[(2R)-1-amino-1-oxopropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](C(N)=O)c1c(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc(C(N)=O)c1C(F)(F)F |
| InChI | InChI=1S/C21H14Cl3F7N2O2/c1-7(18(32)34)15-9(2-3-10(19(33)35)16(15)21(29,30)31)14(25)6-11(20(26,27)28)8-4-12(22)17(24)13(23)5-8/h2-7,11H,1H3,(H2,32,34)(H2,33,35)/b14-6-/t7-,11?/m1/s1 |
| InChIKey | UBPDTKZIANUVDT-GASBPUIKSA-N |
| XLogP | 7.01 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|