C24H19Cl3F7N3O2 — CID 140800264
3-[(1S)-1-(cyclopropylcarbamoylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800264) has the molecular formula C24H19Cl3F7N3O2 and a molecular weight of 620.78 g/mol. Its IUPAC name is 3-[(1S)-1-(cyclopropylcarbamoylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 3-[(1S)-1-(cyclopropylcarbamoylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800264 |
| Molecular Formula | C24H19Cl3F7N3O2 |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 619.04 |
| IUPAC Name | 3-[(1S)-1-(cyclopropylcarbamoylamino)ethyl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](NC(=O)NC1CC1)c1c(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc(C(N)=O)c1C(F)(F)F |
| InChI | InChI=1S/C24H19Cl3F7N3O2/c1-9(36-22(39)37-11-2-3-11)18-12(4-5-13(21(35)38)19(18)24(32,33)34)17(28)8-14(23(29,30)31)10-6-15(25)20(27)16(26)7-10/h4-9,11,14H,2-3H2,1H3,(H2,35,38)(H2,36,37,39)/b17-8-/t9-,14?/m0/s1 |
| InChIKey | ZWFMGPOMXAHXQG-VDKGHRCVSA-N |
| XLogP | 7.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|