C22H17Cl3F7NO3S — CID 140800283
3-[(2R)-1-methylsulfonylpropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 140800283) has the molecular formula C22H17Cl3F7NO3S and a molecular weight of 614.79 g/mol. Its IUPAC name is 3-[(2R)-1-methylsulfonylpropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 3-[(2R)-1-methylsulfonylpropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140800283 |
| Molecular Formula | C22H17Cl3F7NO3S |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 612.99 |
| IUPAC Name | 3-[(2R)-1-methylsulfonylpropan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](CS(C)(=O)=O)c1c(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc(C(N)=O)c1C(F)(F)F |
| InChI | InChI=1S/C22H17Cl3F7NO3S/c1-9(8-37(2,35)36)17-11(3-4-12(20(33)34)18(17)22(30,31)32)16(26)7-13(21(27,28)29)10-5-14(23)19(25)15(24)6-10/h3-7,9,13H,8H2,1-2H3,(H2,33,34)/b16-7-/t9-,13?/m0/s1 |
| InChIKey | FZDBUUYXIAADID-CJFJGOTPSA-N |
| XLogP | 7.57 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|