C25H19Cl3F9NO — CID 146774698
2-[(4,4-difluorocyclohexyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone (PubChem CID 146774698) has the molecular formula C25H19Cl3F9NO and a molecular weight of 626.77 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-[(4,4-difluorocyclohexyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 146774698 |
| Molecular Formula | C25H19Cl3F9NO |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 625.04 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)amino]-1-[4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CNC1CCC(F)(F)CC1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H19Cl3F9NO/c26-18-8-13(9-19(27)22(18)28)16(24(32,33)34)10-20(29)12-1-2-15(17(7-12)25(35,36)37)21(39)11-38-14-3-5-23(30,31)6-4-14/h1-2,7-10,14,16,38H,3-6,11H2/b20-10- |
| InChIKey | RSMNVIXENUTTEU-JMIUGGIZSA-N |
| XLogP | 9.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|