C26H21Cl2F9O — CID 158790677
1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone (PubChem CID 158790677) has the molecular formula C26H21Cl2F9O and a molecular weight of 591.34 g/mol. Its IUPAC name is 1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone.
| Compound Name | 1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 158790677 |
| Molecular Formula | C26H21Cl2F9O |
| Molecular Weight | 591.34 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | 1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone |
| SMILES | Cc1cc(C(/C=C(\F)c2ccc(C(=O)CC3CCC(F)(F)CC3)c(C(F)(F)F)c2)C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C26H21Cl2F9O/c1-13-8-16(11-20(27)23(13)28)18(25(32,33)34)12-21(29)15-2-3-17(19(10-15)26(35,36)37)22(38)9-14-4-6-24(30,31)7-5-14/h2-3,8,10-12,14,18H,4-7,9H2,1H3/b21-12- |
| InChIKey | ISFQWYQUINKETR-MTJSOVHGSA-N |
| XLogP | 10.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.34 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |