C25H18Br2ClF9O — CID 147560124
1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone (PubChem CID 147560124) has the molecular formula C25H18Br2ClF9O and a molecular weight of 700.66 g/mol. Its IUPAC name is 1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone.
| Compound Name | 1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 147560124 |
| Molecular Formula | C25H18Br2ClF9O |
| Molecular Weight | 700.66 g/mol |
| Exact Mass | 697.93 |
| IUPAC Name | 1-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-(4,4-difluorocyclohexyl)ethanone |
| SMILES | O=C(CC1CCC(F)(F)CC1)c1ccc(/C(F)=C/C(c2cc(Br)c(Cl)c(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H18Br2ClF9O/c26-18-9-14(10-19(27)22(18)28)16(24(32,33)34)11-20(29)13-1-2-15(17(8-13)25(35,36)37)21(38)7-12-3-5-23(30,31)6-4-12/h1-2,8-12,16H,3-7H2/b20-11- |
| InChIKey | FSLSLQAIIYCLRS-JAIQZWGSSA-N |
| XLogP | 10.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.66 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|