C26H18Br2ClF10NO2 — CID 158347285
1-[2-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-oxoethyl]-N-methyl-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide (PubChem CID 158347285) has the molecular formula C26H18Br2ClF10NO2 and a molecular weight of 761.68 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-oxoethyl]-N-methyl-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[2-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-oxoethyl]-N-methyl-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 158347285 |
| Molecular Formula | C26H18Br2ClF10NO2 |
| Molecular Weight | 761.68 g/mol |
| Exact Mass | 758.92 |
| IUPAC Name | 1-[2-[4-[(Z)-3-(3,5-dibromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-oxoethyl]-N-methyl-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
| SMILES | CN(CC(F)(F)F)C(=O)C1(CC(=O)c2ccc(/C(F)=C/C(c3cc(Br)c(Cl)c(Br)c3)C(F)(F)F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H18Br2ClF10NO2/c1-40(11-24(31,32)33)22(42)23(4-5-23)10-20(41)14-3-2-12(6-16(14)26(37,38)39)19(30)9-15(25(34,35)36)13-7-17(27)21(29)18(28)8-13/h2-3,6-9,15H,4-5,10-11H2,1H3/b19-9- |
| InChIKey | GRWRDTQVGDFLRY-OCKHKDLRSA-N |
| XLogP | 9.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.68 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|