C24H15Cl2F7N4O — CID 135341333
4-[3-(3,4-dichloro-5-ethenylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N'-pyrimidin-2-yl-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341333) has the molecular formula C24H15Cl2F7N4O and a molecular weight of 579.30 g/mol. Its IUPAC name is 4-[3-(3,4-dichloro-5-ethenylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N'-pyrimidin-2-yl-2-(trifluoromethyl)benzohydrazide.
| Compound Name | 4-[3-(3,4-dichloro-5-ethenylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N'-pyrimidin-2-yl-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341333 |
| Molecular Formula | C24H15Cl2F7N4O |
| Molecular Weight | 579.30 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | 4-[3-(3,4-dichloro-5-ethenylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N'-pyrimidin-2-yl-2-(trifluoromethyl)benzohydrazide |
| SMILES | C=Cc1cc(C(C=C(F)c2ccc(C(=O)NNc3ncccn3)c(C(F)(F)F)c2)C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C24H15Cl2F7N4O/c1-2-12-8-14(10-18(25)20(12)26)16(23(28,29)30)11-19(27)13-4-5-15(17(9-13)24(31,32)33)21(38)36-37-22-34-6-3-7-35-22/h2-11,16H,1H2,(H,36,38)(H,34,35,37) |
| InChIKey | QNBNGBUTYIBNCV-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.30 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|