C25H13Cl3F10N2O — CID 130269413
4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)benzamide (PubChem CID 130269413) has the molecular formula C25H13Cl3F10N2O and a molecular weight of 653.73 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)benzamide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 130269413 |
| Molecular Formula | C25H13Cl3F10N2O |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 651.99 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-(2,2,2-trifluoro-1-pyridin-2-ylethyl)benzamide |
| SMILES | O=C(NC(c1ccccn1)C(F)(F)F)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H13Cl3F10N2O/c26-16-8-12(9-17(27)20(16)28)14(23(30,31)32)10-18(29)11-4-5-13(15(7-11)24(33,34)35)22(41)40-21(25(36,37)38)19-3-1-2-6-39-19/h1-10,14,21H,(H,40,41)/b18-10- |
| InChIKey | KZNXRQKUWGTWGA-ZDLGFXPLSA-N |
| XLogP | 9.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|