C27H19Cl2F10NO2 — CID 147119835
(2S)-4-[4-[(Z)-3-(3,4-dichloro-5-prop-1-ynylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 147119835) has the molecular formula C27H19Cl2F10NO2 and a molecular weight of 650.34 g/mol. Its IUPAC name is (2S)-4-[4-[(Z)-3-(3,4-dichloro-5-prop-1-ynylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[4-[(Z)-3-(3,4-dichloro-5-prop-1-ynylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 147119835 |
| Molecular Formula | C27H19Cl2F10NO2 |
| Molecular Weight | 650.34 g/mol |
| Exact Mass | 649.06 |
| IUPAC Name | (2S)-4-[4-[(Z)-3-(3,4-dichloro-5-prop-1-ynylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC#Cc1cc(C(/C=C(\F)c2ccc(C(=O)C[C@H](C)C(=O)NCC(F)(F)F)c(C(F)(F)F)c2)C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C27H19Cl2F10NO2/c1-3-4-15-8-16(10-20(28)23(15)29)18(26(34,35)36)11-21(30)14-5-6-17(19(9-14)27(37,38)39)22(41)7-13(2)24(42)40-12-25(31,32)33/h5-6,8-11,13,18H,7,12H2,1-2H3,(H,40,42)/b21-11-/t13-,18?/m0/s1 |
| InChIKey | BODHDFGEWZHQEU-YWKWISHISA-N |
| XLogP | 8.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.34 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|