C23H18BrCl3F6N2O2 — CID 130272735
2-bromo-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]benzamide (PubChem CID 130272735) has the molecular formula C23H18BrCl3F6N2O2 and a molecular weight of 654.66 g/mol. Its IUPAC name is 2-bromo-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]benzamide |
|---|---|
| PubChem CID | 130272735 |
| Molecular Formula | C23H18BrCl3F6N2O2 |
| Molecular Weight | 654.66 g/mol |
| Exact Mass | 651.95 |
| IUPAC Name | 2-bromo-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)CNC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(C)(F)F)cc1Br |
| InChI | InChI=1S/C23H18BrCl3F6N2O2/c1-22(29,30)14(12-6-16(25)20(27)17(26)7-12)8-18(28)11-3-4-13(15(24)5-11)21(37)34-9-19(36)35(2)10-23(31,32)33/h3-8,14H,9-10H2,1-2H3,(H,34,37)/b18-8- |
| InChIKey | IDZJQYWBZCFSHD-LSCVHKIXSA-N |
| XLogP | 7.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.66 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|