C20H13Cl3F6O — CID 130289487
1-[2-(trifluoromethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]ethanone (PubChem CID 130289487) has the molecular formula C20H13Cl3F6O and a molecular weight of 489.67 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]ethanone.
| Compound Name | 1-[2-(trifluoromethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]ethanone |
|---|---|
| PubChem CID | 130289487 |
| Molecular Formula | C20H13Cl3F6O |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 1-[2-(trifluoromethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)pent-1-enyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(C)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H13Cl3F6O/c1-9(30)12-4-3-10(5-14(12)20(27,28)29)17(24)8-13(19(2,25)26)11-6-15(21)18(23)16(22)7-11/h3-8,13H,1-2H3/b17-8- |
| InChIKey | RWGKTRADTCIJMD-IUXPMGMMSA-N |
| XLogP | 8.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|