C20H14Cl3F5O — CID 130290952
1-[2-(1,1-difluoroethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethanone (PubChem CID 130290952) has the molecular formula C20H14Cl3F5O and a molecular weight of 471.68 g/mol. Its IUPAC name is 1-[2-(1,1-difluoroethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethanone.
| Compound Name | 1-[2-(1,1-difluoroethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethanone |
|---|---|
| PubChem CID | 130290952 |
| Molecular Formula | C20H14Cl3F5O |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 1-[2-(1,1-difluoroethyl)-4-[(Z)-1,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)F)cc1C(C)(F)F |
| InChI | InChI=1S/C20H14Cl3F5O/c1-9(29)12-4-3-10(5-14(12)20(2,27)28)17(24)8-13(19(25)26)11-6-15(21)18(23)16(22)7-11/h3-8,13,19H,1-2H3/b17-8- |
| InChIKey | GPNFFVMCWCSWGK-IUXPMGMMSA-N |
| XLogP | 8.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|