C25H20BrCl3F7NO2 — CID 146802168
(2S)-4-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-ethyl-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 146802168) has the molecular formula C25H20BrCl3F7NO2 and a molecular weight of 685.69 g/mol. Its IUPAC name is (2S)-4-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-ethyl-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-ethyl-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 146802168 |
| Molecular Formula | C25H20BrCl3F7NO2 |
| Molecular Weight | 685.69 g/mol |
| Exact Mass | 682.96 |
| IUPAC Name | (2S)-4-[2-bromo-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-N-ethyl-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCN(CC(F)(F)F)C(=O)[C@@H](C)CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C25H20BrCl3F7NO2/c1-3-37(11-24(31,32)33)23(39)12(2)6-21(38)15-5-4-13(7-17(15)26)20(30)10-16(25(34,35)36)14-8-18(27)22(29)19(28)9-14/h4-5,7-10,12,16H,3,6,11H2,1-2H3/b20-10-/t12-,16?/m0/s1 |
| InChIKey | RYCXPSCTIUVDIY-PJXOFOQKSA-N |
| XLogP | 9.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.69 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|