C24H18BrClF10OS — CID 160812351
(3S)-1-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one (PubChem CID 160812351) has the molecular formula C24H18BrClF10OS and a molecular weight of 659.81 g/mol. Its IUPAC name is (3S)-1-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one.
| Compound Name | (3S)-1-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one |
|---|---|
| PubChem CID | 160812351 |
| Molecular Formula | C24H18BrClF10OS |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 657.98 |
| IUPAC Name | (3S)-1-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-3-methyl-4-(2,2,2-trifluoroethylsulfanyl)butan-1-one |
| SMILES | C[C@H](CSCC(F)(F)F)CC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)cc(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H18BrClF10OS/c1-12(10-38-11-22(28,29)30)4-21(37)17-3-2-13(7-19(17)24(34,35)36)20(27)9-18(23(31,32)33)14-5-15(25)8-16(26)6-14/h2-3,5-9,12,18H,4,10-11H2,1H3/b20-9-/t12-,18?/m0/s1 |
| InChIKey | SELPDESTQKXJRA-IMGHVSCMSA-N |
| XLogP | 10.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |