C23H15BrClF10NO2 — CID 147728126
4-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 147728126) has the molecular formula C23H15BrClF10NO2 and a molecular weight of 642.71 g/mol. Its IUPAC name is 4-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 147728126 |
| Molecular Formula | C23H15BrClF10NO2 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 640.98 |
| IUPAC Name | 4-[4-[(Z)-3-(3-bromo-5-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)cc(Br)c2)C(F)(F)F)cc1C(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C23H15BrClF10NO2/c24-13-5-12(6-14(25)8-13)16(22(30,31)32)9-18(26)11-1-2-15(17(7-11)23(33,34)35)19(37)3-4-20(38)36-10-21(27,28)29/h1-2,5-9,16H,3-4,10H2,(H,36,38)/b18-9- |
| InChIKey | GXWUUMJUEBMGOI-NVMNQCDNSA-N |
| XLogP | 8.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |