C25H22ClF10NO3S — CID 130237456
4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237456) has the molecular formula C25H22ClF10NO3S and a molecular weight of 641.96 g/mol. Its IUPAC name is 4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237456 |
| Molecular Formula | C25H22ClF10NO3S |
| Molecular Weight | 641.96 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | 4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C(/C=C(\F)c2ccc(C(=O)NC(C)CS(=O)(=O)CC(F)(F)F)c(C(F)(F)F)c2)C(F)(F)F)cc(C)c1Cl |
| InChI | InChI=1S/C25H22ClF10NO3S/c1-12-6-16(7-13(2)21(12)26)18(24(31,32)33)9-20(27)15-4-5-17(19(8-15)25(34,35)36)22(38)37-14(3)10-41(39,40)11-23(28,29)30/h4-9,14,18H,10-11H2,1-3H3,(H,37,38)/b20-9- |
| InChIKey | XRGIXINBVDMZKT-UKWGHVSLSA-N |
| XLogP | 7.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.96 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |