C25H21ClF10N2O2 — CID 130238268
4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide (PubChem CID 130238268) has the molecular formula C25H21ClF10N2O2 and a molecular weight of 606.89 g/mol. Its IUPAC name is 4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide.
| Compound Name | 4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 130238268 |
| Molecular Formula | C25H21ClF10N2O2 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | 4-[(Z)-3-(4-chloro-3,5-dimethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide |
| SMILES | Cc1cc(C(/C=C(\F)c2ccc(C(=O)NC(C)NC(=O)CC(F)(F)F)c(C(F)(F)F)c2)C(F)(F)F)cc(C)c1Cl |
| InChI | InChI=1S/C25H21ClF10N2O2/c1-11-6-15(7-12(2)21(11)26)17(24(31,32)33)9-19(27)14-4-5-16(18(8-14)25(34,35)36)22(40)38-13(3)37-20(39)10-23(28,29)30/h4-9,13,17H,10H2,1-3H3,(H,37,39)(H,38,40)/b19-9- |
| InChIKey | GDKXIPSHLOUCEF-OCKHKDLRSA-N |
| XLogP | 7.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|