C23H16ClF12NO3S — CID 130237492
4-[(Z)-3-(3-chloro-4,5-difluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237492) has the molecular formula C23H16ClF12NO3S and a molecular weight of 649.88 g/mol. Its IUPAC name is 4-[(Z)-3-(3-chloro-4,5-difluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3-chloro-4,5-difluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237492 |
| Molecular Formula | C23H16ClF12NO3S |
| Molecular Weight | 649.88 g/mol |
| Exact Mass | 649.03 |
| IUPAC Name | 4-[(Z)-3-(3-chloro-4,5-difluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2cc(F)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H16ClF12NO3S/c1-10(8-41(39,40)9-21(28,29)30)37-20(38)13-3-2-11(4-15(13)23(34,35)36)17(25)7-14(22(31,32)33)12-5-16(24)19(27)18(26)6-12/h2-7,10,14H,8-9H2,1H3,(H,37,38)/b17-7-/t10-,14?/m1/s1 |
| InChIKey | LYJNGMOTUCYHMU-WJNQMGPJSA-N |
| XLogP | 7.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.88 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|