C22H19Cl3F6N2S — CID 144653333
2-[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]-N-(2,2,2-trifluoroethyl)propanethioamide (PubChem CID 144653333) has the molecular formula C22H19Cl3F6N2S and a molecular weight of 563.82 g/mol. Its IUPAC name is 2-[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]-N-(2,2,2-trifluoroethyl)propanethioamide.
| Compound Name | 2-[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]-N-(2,2,2-trifluoroethyl)propanethioamide |
|---|---|
| PubChem CID | 144653333 |
| Molecular Formula | C22H19Cl3F6N2S |
| Molecular Weight | 563.82 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 2-[2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]anilino]-N-(2,2,2-trifluoroethyl)propanethioamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1NC(C)C(=S)NCC(F)(F)F |
| InChI | InChI=1S/C22H19Cl3F6N2S/c1-11-7-13(4-6-18(11)33-12(2)20(34)32-10-21(26,27)28)3-5-15(22(29,30)31)14-8-16(23)19(25)17(24)9-14/h3-9,12,15,33H,10H2,1-2H3,(H,32,34)/b5-3+ |
| InChIKey | XVPQDGVNPHWSEG-HWKANZROSA-N |
| XLogP | 8.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.82 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|