C29H23BrCl3F3N2O3 — CID 123785760
2-bromo-N-[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 123785760) has the molecular formula C29H23BrCl3F3N2O3 and a molecular weight of 690.77 g/mol. Its IUPAC name is 2-bromo-N-[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 123785760 |
| Molecular Formula | C29H23BrCl3F3N2O3 |
| Molecular Weight | 690.77 g/mol |
| Exact Mass | 687.99 |
| IUPAC Name | 2-bromo-N-[1-[(4-methoxyphenyl)methylcarbamoyl]cyclopropyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | COc1ccc(CNC(=O)C2(NC(=O)c3ccc(C=CC(c4cc(Cl)c(Cl)c(Cl)c4)C(F)(F)F)cc3Br)CC2)cc1 |
| InChI | InChI=1S/C29H23BrCl3F3N2O3/c1-41-19-6-2-17(3-7-19)15-37-27(40)28(10-11-28)38-26(39)20-8-4-16(12-22(20)30)5-9-21(29(34,35)36)18-13-23(31)25(33)24(32)14-18/h2-9,12-14,21H,10-11,15H2,1H3,(H,37,40)(H,38,39) |
| InChIKey | XZTXNZZLZZJGJH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.77 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|