C22H17Cl4F3N2O2 — CID 129059776
2-chloro-4-[(E)-3-(3,4,5-trichlorophenyl)prop-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide (PubChem CID 129059776) has the molecular formula C22H17Cl4F3N2O2 and a molecular weight of 540.20 g/mol. Its IUPAC name is 2-chloro-4-[(E)-3-(3,4,5-trichlorophenyl)prop-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide.
| Compound Name | 2-chloro-4-[(E)-3-(3,4,5-trichlorophenyl)prop-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 129059776 |
| Molecular Formula | C22H17Cl4F3N2O2 |
| Molecular Weight | 540.20 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | 2-chloro-4-[(E)-3-(3,4,5-trichlorophenyl)prop-1-enyl]-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]benzamide |
| SMILES | O=C(NC1(C(=O)NCC(F)(F)F)CC1)c1ccc(/C=C/Cc2cc(Cl)c(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C22H17Cl4F3N2O2/c23-15-8-12(2-1-3-13-9-16(24)18(26)17(25)10-13)4-5-14(15)19(32)31-21(6-7-21)20(33)30-11-22(27,28)29/h1-2,4-5,8-10H,3,6-7,11H2,(H,30,33)(H,31,32)/b2-1+ |
| InChIKey | CCFRNSKSIMNEDI-OWOJBTEDSA-N |
| XLogP | 6.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.20 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|