C24H25Cl3F3N3O2 — CID 90227138
N-[2-[ethylcarbamoyl(methyl)amino]ethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90227138) has the molecular formula C24H25Cl3F3N3O2 and a molecular weight of 550.84 g/mol. Its IUPAC name is N-[2-[ethylcarbamoyl(methyl)amino]ethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[2-[ethylcarbamoyl(methyl)amino]ethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90227138 |
| Molecular Formula | C24H25Cl3F3N3O2 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | N-[2-[ethylcarbamoyl(methyl)amino]ethyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CCNC(=O)N(C)CCNC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C24H25Cl3F3N3O2/c1-4-31-23(35)33(3)10-9-32-22(34)17-7-5-15(11-14(17)2)6-8-18(24(28,29)30)16-12-19(25)21(27)20(26)13-16/h5-8,11-13,18H,4,9-10H2,1-3H3,(H,31,35)(H,32,34)/b8-6+ |
| InChIKey | HTPWNLOALXIMPE-SOFGYWHQSA-N |
| XLogP | 6.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|