C23H16Cl4F3N3O — CID 126728556
N'-(6-chloro-3-pyridinyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide (PubChem CID 126728556) has the molecular formula C23H16Cl4F3N3O and a molecular weight of 549.21 g/mol. Its IUPAC name is N'-(6-chloro-3-pyridinyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide.
| Compound Name | N'-(6-chloro-3-pyridinyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 126728556 |
| Molecular Formula | C23H16Cl4F3N3O |
| Molecular Weight | 549.21 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | N'-(6-chloro-3-pyridinyl)-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzohydrazide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NNc1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H16Cl4F3N3O/c1-12-8-13(2-5-16(12)22(34)33-32-15-4-7-20(26)31-11-15)3-6-17(23(28,29)30)14-9-18(24)21(27)19(25)10-14/h2-11,17,32H,1H3,(H,33,34)/b6-3+ |
| InChIKey | FBPHGARWDXTBSC-ZZXKWVIFSA-N |
| XLogP | 8.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.21 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|