C19H15Cl2F4N — CID 138701824
5-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-1-methyl-2,3-dihydroindole (PubChem CID 138701824) has the molecular formula C19H15Cl2F4N and a molecular weight of 404.23 g/mol. Its IUPAC name is 5-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-1-methyl-2,3-dihydroindole.
| Compound Name | 5-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 138701824 |
| Molecular Formula | C19H15Cl2F4N |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 5-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-1-methyl-2,3-dihydroindole |
| SMILES | CN1CCc2cc(/C=C/C(c3cc(Cl)c(F)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H15Cl2F4N/c1-26-7-6-12-8-11(3-5-17(12)26)2-4-14(19(23,24)25)13-9-15(20)18(22)16(21)10-13/h2-5,8-10,14H,6-7H2,1H3/b4-2+ |
| InChIKey | ZGNCQFUWHPMUQH-DUXPYHPUSA-N |
| XLogP | 6.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|